| Melting point |
273°C |
| Boiling point |
322.13°C (rough estimate) |
| Density |
1.2961 (rough estimate) |
| refractive index |
1.6110 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble in water, slightly soluble in ethanol (96 per cent), very slightly soluble in methylene chloride |
| form |
Solid |
| color |
White to Almost white |
| PH |
pH (20g/l, 25℃) : 3.5～4.5 |
| biological source |
synthetic (organic) |
| Water Solubility |
Soluble in water. Slightly soluble in diethyl ether and alcohol. |
| Merck |
14,4763 |
| BRN |
3568329 |
| BCS Class |
3 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
pharmaceutical |
| InChI |
1S/C8H8N4.ClH/c9-11-8-7-4-2-1-3-6(7)5-10-12-8;/h1-5,7H,9H2;1H/b11-8-; |
| InChIKey |
ZUXNZUWOTSUBMN-UHFFFAOYSA-N |
| SMILES |
Cl[H].N\N=C1/N=NC=C2C=CC=CC12 |
| CAS DataBase Reference |
304-20-1(CAS DataBase Reference) |
| EPA Substance Registry System |
1(2H)-Phthalazinone, hydrazone, monohydrochloride (304-20-1) |
