| Melting point |
252 °C (dec.)(lit.) |
| Boiling point |
410.75°C (rough estimate) |
| Density |
1.3594 (rough estimate) |
| refractive index |
1.4430 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
Powder |
| pka |
10.12±0.40(Predicted) |
| color |
Light beige to beige-pink |
| Water Solubility |
Insoluble in water. Soluble with decomposition in aqueous sodium carbonate (deep red color) and in sodium hydroxide solutions (deep blue color). |
| Merck |
14,4775 |
| BRN |
1895666 |
| InChI |
InChI=1S/C18H14O8/c19-13-9-5-1-3-7-11(9)17(23,24)15(13,21)16(22)14(20)10-6-2-4-8-12(10)18(16,25)26/h1-8,21-26H |
| InChIKey |
QHVADKNWNMILPQ-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)C(O)(O)C1(O)C1(O)C(O)(O)C2=C(C1=O)C=CC=C2 |
| CAS DataBase Reference |
5950-69-6(CAS DataBase Reference) |
| EPA Substance Registry System |
[2,2'-Bi-1H-indene]-1,1'-dione, 2,2',3,3'-tetrahydro-2,2',3,3,3',3'-hexahydroxy- (5950-69-6) |
