| Melting point |
~245 °C (dec.) |
| Boiling point |
323.23°C (rough estimate) |
| Density |
1.1793 (rough estimate) |
| refractive index |
86 ° (C=2, H2O) |
| storage temp. |
Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| pka |
3.25(at 25℃) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
84.9°(C=1.20 g/100ml H2O) |
| InChI |
InChI=1S/C8H16N2O3/c1-5(2)3-6(9)8(13)10-4-7(11)12/h5-6H,3-4,9H2,1-2H3,(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey |
LESXFEZIFXFIQR-LURJTMIESA-N |
| SMILES |
C(O)(=O)CNC(=O)[C@H](CC(C)C)N |
| CAS DataBase Reference |
686-50-0(CAS DataBase Reference) |