| Melting point |
221°C (rough estimate) |
| Boiling point |
699.7±55.0 °C(Predicted) |
| alpha |
D25 -290° (c = 0.08 in ethanol) |
| Density |
1.4069 (rough estimate) |
| refractive index |
1.6510 (estimate) |
| Flash point |
2℃ |
| storage temp. |
2-8°C |
| solubility |
chloroform: 10 mg/mL, clear, colorless |
| form |
White solid |
| pka |
12.90±0.40(Predicted) |
| color |
Monoclinic crystals from MeOH |
| Merck |
13,4454 |
| BRN |
50675 |
| Stability |
Stable for 2 yeara as supplied. Solutions in DMSO may be stored at -20°C for up to 1 month. |
| InChI |
InChI=1S/C13H14N2O4S2/c1-14-10(18)12-5-7-3-2-4-8(17)9(7)15(12)11(19)13(14,6-16)21-20-12/h2-4,8-9,16-17H,5-6H2,1H3/t8-,9-,12+,13+/m0/s1 |
| InChIKey |
FIVPIPIDMRVLAY-RBJBARPLSA-N |
| SMILES |
N12C(=O)[C@@]3(CO)SS[C@@]1(C(=O)N3C)CC1[C@@]2([H])[C@@H](O)C=CC=1 |
