| Melting point |
5 °C(lit.) |
| Boiling point |
170 °C12 mm Hg(lit.) |
| Density |
1.122 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.586(lit.) |
| FEMA |
2952 | 3-PROPYLIDENEPHTHALIDE |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| Odor |
at 10.00 % in dipropylene glycol. celery herbal cortex lovage maple fenugreek phenolic brothy vegetable brown |
| Appearance |
Light yellow to yellow Liquid |
| Odor Type |
herbal |
| biological source |
synthetic |
| JECFA Number |
1168 |
| BRN |
4486 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C11H10O2/c1-2-5-10-8-6-3-4-7-9(8)11(12)13-10/h3-7H,2H2,1H3 |
| InChIKey |
NGSZDVVHIGAMOJ-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)C(=CCC)O1 |
| LogP |
3.19 |
| CAS DataBase Reference |
17369-59-4(CAS DataBase Reference) |
| EPA Substance Registry System |
3-Propylidenephthalide (17369-59-4) |
