| Melting point |
>300°C |
| Density |
1.587[at 20℃] |
| storage temp. |
Store at room temperature, keep dry and cool |
| form |
Powder |
| color |
White crystalline |
| Odor |
Odorless |
| PH Range |
7.5 |
| Water Solubility |
Soluble in water. Insoluble in acid and organic liquids |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C10H16N2O8.Mg.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+2;+1/p-4 |
| InChIKey |
ODIJDXMMSMDZBJ-UHFFFAOYSA-J |
| SMILES |
O=C1CN23CCN45CC(=O)[O-][Mg+2]24([O-]C(=O)C5)([O-]C(=O)C3)[O-]1.[Na+] |
| LogP |
-10.42 at 20℃ |
| CAS DataBase Reference |
14402-88-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Magnesate(2-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-.kappa.O)methyl]glycinato-.kappa.N,.kappa.O]](4-)]-, disodium, (OC-6-21)- (14402-88-1) |