| Melting point |
250 °C (dec.) (lit.) |
| Boiling point |
434.18°C (rough estimate) |
| Density |
1.46 g/cm3 at 20 °C |
| bulk density |
600kg/m3 |
| vapor pressure |
<0.013 hPa (20 °C) |
| refractive index |
n20/D 1.363 |
| Flash point |
>400°C DIN 51758 |
| storage temp. |
2-8°C |
| solubility |
3 M NaOH: 100 mg/mL |
| pka |
pKa 2 (Uncertain);10.26 (Uncertain) |
| form |
crystalline |
| color |
White to almost white |
| Odor |
Odorless |
| PH Range |
2.5 at 10 g/l at 23 °C |
| PH |
2.5 (10g/l, H2O, 23℃)(slurry) |
| Water Solubility |
0.5 g/L (25 ºC) |
| λmax |
λ: 280 nm Amax: ≤0.25 |
| Decomposition |
240 °C |
| Merck |
14,3517 |
| BRN |
1716295 |
| Stability |
Stable. Incompatible with copper, copper alloys, nickel, aluminium, strong oxidizing agents, strong bases |
| Cosmetics Ingredients Functions |
CHELATING |
| InChI |
1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey |
KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| SMILES |
OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| LogP |
-0.836 (est) |
| CAS DataBase Reference |
60-00-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
N,N'-1,2-Ethane diylbis-(N-(carboxymethyl)glycine)(60-00-4) |
| EPA Substance Registry System |
Ethylenediaminetetraacetic acid (60-00-4) |
