| Melting point |
1-2 °C (lit.) |
| Boiling point |
218-219 °C (lit.) |
| Density |
1.052 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.44(lit.) |
| Flash point |
197 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
3.1g/l |
| form |
Liquid |
| color |
Clear colorless to slightly yellow |
| Water Solubility |
immiscible |
| BRN |
775347 |
| Dielectric constant |
6.5（23℃） |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents, acids, bases, reducing agents. |
| InChI |
1S/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey |
IEPRKVQEAMIZSS-AATRIKPKSA-N |
| SMILES |
[H]\C(=C(\[H])C(=O)OCC)C(=O)OCC |
| LogP |
2.200 (est) |
| Surface tension |
31.4 mN/m at 22° |
| CAS DataBase Reference |
623-91-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Butenedioic acid (E)-, diethyl ester(623-91-6) |
| EPA Substance Registry System |
Diethyl fumarate (623-91-6) |
