| Melting point |
151-153 C |
| alpha |
D25+6.35° (c = 0.07 in ethanol) |
| Boiling point |
357.92°C (rough estimate) |
| Density |
1.48 |
| refractive index |
1.4359 (estimate) |
| Flash point |
-3 °C |
| storage temp. |
-20°C |
| solubility |
DMF: 30 mg/ml; DMSO: 25 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form |
solution (ethanol: 2-propanol 95:5) |
| pka |
11.91±0.70(Predicted) |
| color |
White to off-white |
| biological source |
Fusarium sp. (Fusarium asiaticum) |
| Merck |
13,10092 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| InChI |
InChI=1/C15H20O6/c1-7-3-9-14(5-16,11(19)10(7)18)13(2)4-8(17)12(21-9)15(13)6-20-15/h3,8-9,11-12,16-17,19H,4-6H2,1-2H3/t8-,9-,11-,12-,13-,14-,15+/s3 |
| InChIKey |
LINOMUASTDIRTM-QUKTVYMZNA-N |
| SMILES |
[C@@]12(CO1)[C@@]1([H])[C@H](O)C[C@]2(C)[C@@]2(CO)[C@H](O)C(C(C)=C[C@@]2([H])O1)=O |&1:0,3,5,8,10,13,19,r| |
| LogP |
-1.250 (est) |
| CAS DataBase Reference |
51481-10-8 |