| Melting point |
174-176℃ |
| Boiling point |
394.13°C (rough estimate) |
| Density |
1.058 |
| refractive index |
1.5404 (estimate) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 10 mg/ml |
| form |
A solid |
| pka |
4.66±0.40(Predicted) |
| color |
White to yellow |
| Major Application |
metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| InChI |
InChI=1S/C20H28O2/c1-13(2)14-6-8-16-15(12-14)7-9-17-19(16,3)10-5-11-20(17,4)18(21)22/h6,8,12-13,17H,5,7,9-11H2,1-4H3,(H,21,22)/t17-,19-,20-/m1/s1 |
| InChIKey |
NFWKVWVWBFBAOV-UHFFFAOYSA-N |
| SMILES |
[C@@]1(C)(C(O)=O)[C@@]2([H])[C@@](C)(C3=C(CC2)C=C(C(C)C)C=C3)CCC1 |
| LogP |
6.120 (est) |
| EPA Substance Registry System |
Dehydroabietic acid (1740-19-8) |