| Melting point |
90-100° |
| Boiling point |
573.3±50.0 °C(Predicted) |
| Density |
1.1736 (estimate) |
| storage temp. |
Refrigerator, Under Inert Atmosphere |
| solubility |
Practically insoluble in water, freely soluble in acetone and in methylene chloride, slightly soluble in ethanol (96 per cent). |
| form |
Solid |
| color |
White to Off-White |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChIKey |
FBRAWBYQGRLCEK-JGSYYNBSNA-N |
| SMILES |
[C@]1(C(=O)CCl)(OC(=O)CCC)[C@@H](C)C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@]12C |&1:0,11,14,16,26,28,33,r| |
| CAS DataBase Reference |
25122-57-0(CAS DataBase Reference) |
