| Melting point |
242-244°C |
| Boiling point |
482.340±45.00 °C(Press: 760.00 Torr)(predicted) |
| Density |
1.313±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. |
2-8°C |
| solubility |
Soluble in DMSO (up to 40 mg/ml) or in Ethanol (up to 10 mg/ml). |
| form |
solid |
| pka |
13.175±0.60(predicted) |
| color |
Off-white |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| InChI |
1S/C16H18N2O3/c1-16(2)15(20)14(18-7-3-4-13(18)19)11-8-10(9-17)5-6-12(11)21-16/h5-6,8,14-15,20H,3-4,7H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey |
TVZCRIROJQEVOT-CABCVRRESA-N |
| SMILES |
CC1(C)Oc2ccc(cc2[C@H]([C@@H]1O)N3CCCC3=O)C#N |
