| Melting point |
>200℃ |
| storage temp. |
room temp |
| solubility |
Soluble in water, ethanol |
| form |
Crystals or Crystalline Powder |
| pka |
2.5, 11.3(at 25℃) |
| Colour Index |
52000 |
| color |
Dark green |
| Odor |
Stench odour |
| PH Range |
~ 6.8 |
| Water Solubility |
Soluble in water (~2.5 mg/ml at 25°C), and HOAc: H2O (1:1) (1 mg/ml). Insoluble in ethanol. |
| λmax |
598 nm |
| BRN |
4345073 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Biological Applications |
Biosensors; diagnosis of diabetes; detecting ascorbic acid,uric acid,glucose,glomerular deposits |
| InChI |
1S/C12H10N3S.C2H4O2/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;1-2(3)4/h1-6H,13-14H2;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey |
OWXBIRAFHWASMS-UHFFFAOYSA-M |
| SMILES |
CC([O-])=O.Nc1ccc2nc3ccc(N)cc3[s+]c2c1 |
| CAS DataBase Reference |
78338-22-4(CAS DataBase Reference) |
