| Melting point |
216-218 °C |
| storage temp. |
2-8°C |
| solubility |
H2O: 25 mg/mL, clear, colorless |
| form |
White to off-white powder. |
| color |
White |
| biological source |
synthetic (organic) |
| Water Solubility |
Soluble in water (4 mg/ml, warm), DMSO (>25 mg/ml), methanol, acetic acid, dimethyl formamide, and 100% ethanol. |
| BRN |
4628066 |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO, distilled water, or ethanol may be stored at -20° for up to 1 month. |
| InChI |
1S/C16H24N2O4.ClH/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11;/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22);1H/t12-,13+,14+;/m1./s1 |
| InChIKey |
XGDFITZJGKUSDK-UDYGKFQRSA-N |
| SMILES |
O=C(N[C@@H](CC(C)C)C(O)=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1.Cl[H] |
| CAS DataBase Reference |
65391-42-6(CAS DataBase Reference) |
