| Melting point |
>250°C |
| storage temp. |
Amber Vial, -20°C Freezer |
| solubility |
Soluble in water, ethanol, acetone, sodium hydroxide, sulfuric acid |
| form |
powder |
| Colour Index |
23500 |
| color |
Brown |
| PH Range |
1.2(violet)-4(red) |
| Water Solubility |
Soluble in water (20 mg/ml), acetone, ethanol (3 mg/ml), sodium hydroxide, and sulfuric acid. |
| λmax |
500nm |
| Merck |
14,1101 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
Liquid crystal displays, thin films, electronic devices, inks, lithographic printing plates, lithographic
printing plates, printing and dyeing applications, textiles, lubricants, food storage, microorganism staining agent, treatment of apolipoprotein E-related diseases, antifungal agent |
| InChIKey |
VRGQPCWEGKAZKK-DVDDBBOFSA-N |
| SMILES |
S(C1=CC(/N=N/C2C=CC(C3C=CC(/N=N/C4C=C(S(O)(=O)=O)C5=CC=CC=C5C=4N)=C(C)C=3)=CC=2C)=C(N)C2=CC=CC=C12)(O)(=O)=O.[NaH] |
| EPA Substance Registry System |
C.I. Direct Red 2, disodium salt (992-59-6) |
