| Melting point |
151° |
| Boiling point |
514.1±50.0 °C(Predicted) |
| Density |
1.6211 (rough estimate) |
| refractive index |
1.6010 (estimate) |
| storage temp. |
Inert atmosphere,2-8°C |
| solubility |
Practically insoluble in water, freely soluble in acetone and in methylene chloride, sparingly soluble in ethanol (96 per cent). |
| pka |
4.66±0.25(Predicted) |
| form |
Solid |
| color |
White to Light yellow |
| Merck |
14,1065 |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule)
veterinary |
| InChI |
InChI=1S/C17H12Br2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| InChIKey |
WHQCHUCQKNIQEC-UHFFFAOYSA-N |
| SMILES |
C(C1=CC(Br)=C(O)C(Br)=C1)(C1C2=CC=CC=C2OC=1CC)=O |
| CAS DataBase Reference |
3562-84-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Methanone, (3,5-dibromo-4-hydroxyphenyl)(2-ethyl-3-benzofuranyl)- (3562-84-3) |
