| Melting point |
176-178° |
| alpha |
D +87.7° (abs alc) |
| Boiling point |
431.2±18.0 °C(Predicted) |
| Density |
1.053±0.06 g/cm3(Predicted) |
| storage temp. |
Store at RT |
| solubility |
chloroform: 20 mg/mL, clear, colorless |
| pka |
15.12±0.70(Predicted) |
| form |
White solid |
| color |
white |
| Merck |
13,272 |
| BRN |
3211363 |
| Stability |
Stable for 2 years as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 1 month. |
| InChI |
InChI=1/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15+,16-,17+,18-,19-,20-,21+/s3 |
| InChIKey |
AURFZBICLPNKBZ-SYBPFIFISA-N |
| SMILES |
[C@]12([H])CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CC[C@@]1([H])C[C@H](O)CC[C@]21C)C(=O)C |&1:0,4,6,9,11,15,18,22,r| |
| CAS DataBase Reference |
516-54-1(CAS DataBase Reference) |
