| Melting point |
255 °C (dec.)(lit.) |
| storage temp. |
2-8°C |
| solubility |
H2O: may be hazy yellow |
| form |
Crystalline Powder |
| color |
Off-white to beige-yellow |
| Water Solubility |
Soluble in water, ethanol, acetone, glacial acetic acid and methanol. Slightly soluble in chloroform, petroleum ether, toluene, ethyl acetate and acetic anhydride. Insoluble in ether. |
| Sensitive |
Air Sensitive |
| Merck |
14,282 |
| BRN |
5309394 |
| InChI |
InChI=1S/C4H2N2O4.H2O/c7-1-2(8)5-4(10)6-3(1)9;/h(H2,5,6,8,9,10);1H2 |
| InChIKey |
DSXMTJRUNLATRP-UHFFFAOYSA-N |
| SMILES |
O=C1C(NC(=O)NC1=O)=O.O |
| CAS DataBase Reference |
2244-11-3(CAS DataBase Reference) |
| EPA Substance Registry System |
2,4,5,6(1H,3H)-Pyrimidinetetrone, monohydrate (2244-11-3) |