| Melting point |
148-150 °C(lit.) |
| Boiling point |
293.03°C (rough estimate) |
| Density |
1.1603 (rough estimate) |
| refractive index |
1.5200 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
methanol: 50mg/mL, clear to very slightly hazy, yellow to brown |
| form |
Crystalline Powder |
| pka |
3.36±0.10(Predicted) |
| color |
Light yellow to yellow-beige |
| Water Solubility |
Soluble in methanol (50 mg/ml). Insoluble in water. |
| BRN |
2208586 |
| InChI |
InChI=1S/C9H11NO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChIKey |
NEGFNJRAUMCZMY-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=CC(N(C)C)=C1 |
| CAS DataBase Reference |
99-64-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoic acid, 3-(dimethylamino)- (99-64-9) |
