| Melting point |
88-91 °C(lit.) |
| Boiling point |
343.93°C (rough estimate) |
| Density |
1.24 |
| vapor pressure |
0-0.006Pa at 20-50℃ |
| refractive index |
1.5160 (estimate) |
| Flash point |
171 °C |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
11.33±0.46(Predicted) |
| color |
White to Off-White |
| InChI |
InChI=1S/C12H15NO2/c1-8-4-5-11(9(2)6-8)13-12(15)7-10(3)14/h4-6H,7H2,1-3H3,(H,13,15) |
| InChIKey |
HGVIAKXYAZRSEG-UHFFFAOYSA-N |
| SMILES |
C(NC1=CC=C(C)C=C1C)(=O)CC(=O)C |
| LogP |
1.4 at 20℃ and pH6.5-7.5 |
| CAS DataBase Reference |
97-36-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Butanamide, N-(2,4-dimethylphenyl)-3-oxo- (97-36-9) |