| Boiling point |
85-86 °C/12 mmHg (lit.) |
| Density |
1.169 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.389(lit.) |
| Flash point |
162 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Triethylsilyl Trifluoromethanesulfonate is readily sol hydrocarbons, dialkyl ethers, halogenated
solvents. CH2Cl2 is employed most commonly. Reactions in
1,2-dichloroethane proceed faster than those in CCl4 or Et2O.
Protic solvents and THF react with trialkylsilyl triflates and are
therefore not suitable. |
| form |
Fuming Liquid |
| Specific Gravity |
1.169 |
| color |
Clear colorless to light brown |
| Water Solubility |
Miscible with dichloromethane, hydrocarbons, dialkyl ethers and halogenated solvents. Immiscible with water. |
| Sensitive |
Moisture Sensitive |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
3590541 |
| Stability |
Moisture Sensitive and Hygroscopic, Moisture Sensitive And Hygroscopic |
| InChI |
1S/C7H15F3O3SSi/c1-4-15(5-2,6-3)13-14(11,12)7(8,9)10/h4-6H2,1-3H3 |
| InChIKey |
STMPXDBGVJZCEX-UHFFFAOYSA-N |
| SMILES |
CC[Si](CC)(CC)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference |
79271-56-0(CAS DataBase Reference) |
