| Boiling point |
254-258 °C(lit.) |
| Density |
0.873 g/mL at 25 °C(lit.) |
| FEMA |
3542 | 6,10-DIMETHYL-5,9-UNDECADIEN-2-ONE |
| refractive index |
n20/D 1.467(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Amber Vial, Refrigerator, Under inert atmosphere |
| solubility |
Chloroform, Dichloromethane (Slightly) |
| form |
Oil |
| color |
Colourless |
| Odor |
at 100.00 %. fresh rose leaf floral green magnolia aldehydic fruity |
| Odor Type |
floral |
| biological source |
synthetic |
| Water Solubility |
Not miscible or difficult to mix in water. Soluble in alcohol. |
| JECFA Number |
1122 |
| BRN |
1722277 |
| Stability |
Light Sensitive |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C13H22O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey |
HNZUNIKWNYHEJJ-FMIVXFBMSA-N |
| SMILES |
C\C(C)=C\CC\C(C)=C\CCC(C)=O |
| LogP |
4.13 |
| CAS DataBase Reference |
689-67-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
5,9-Undecadien-2-one, 6,10-dimethyl-(689-67-8) |
| EPA Substance Registry System |
5,9-Undecadien-2-one, 6,10-dimethyl- (689-67-8) |