2,6-DICHLOROBENZENESULFONYL CHLORIDE

$7 - $2583.6

Price

Brand	Packaging	Price	Product name
aablocks AA003G0H	5g	$10	2,6-Dichlorobenzenesulfonyl chloride
aablocks AA003G0H	1g	$8	2,6-Dichlorobenzenesulfonyl chloride
aablocks AA003G0H	10g	$19	2,6-Dichlorobenzenesulfonyl chloride
aablocks AA003G0H	25g	$28	2,6-Dichlorobenzenesulfonyl chloride
Activate Scientific AS143844	25g	$87	2,6-Dichlorobenzenesulfonyl chloride
Activate Scientific AS143844	5g	$22	2,6-Dichlorobenzenesulfonyl chloride
Activate Scientific AS143844	100g	$306	2,6-Dichlorobenzenesulfonyl chloride
AHH MT-08361	100g	$297	2,6-Dichlorobenzenesulfonyl chloride
AHH MT-08361	100g	$297	2,6-Dichlorobenzenesulfonyl chloride
AHH MT-08361	100g	$297	2,6-Dichlorobenzenesulfonyl chloride

Melting point	53-56 °C (lit.)
Boiling point	326.0±32.0 °C(Predicted)
Density	1.636±0.06 g/cm3(Predicted)
Flash point	>230 °F
storage temp.	under inert gas (nitrogen or Argon) at 2-8°C
form	powder to crystal
color	White to Light yellow
Water Solubility	Reacts with water.
Sensitive	Moisture Sensitive
BRN	1531023
InChI	1S/C6H3Cl3O2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H
InChIKey	WGGKQIKICKLWGN-UHFFFAOYSA-N
SMILES	Clc1cccc(Cl)c1S(Cl)(=O)=O
CAS DataBase Reference	6579-54-0(CAS DataBase Reference)