| Melting point |
>300°C |
| bulk density |
220kg/m3 |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
Acetonitrile (Slightly), DMSO (Slightly, Heated) |
| form |
Powder |
| color |
White |
| Odor |
Odorless |
| PH |
5.9 (10g/l, H2O, 20℃)(slurry) |
| Water Solubility |
It is moderate soluble in water. |
| λmax |
290-295 nm in water |
| Merck |
14,7313 |
| BRN |
3795146 |
| Exposure limits |
ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| Stability |
Stable. Incompatible with mineral acids, organic acids, strong oxidizing agents. |
| InChI |
1S/2C12H11NO3S.Ba/c2*14-17(15,16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10;/h2*1-9,13H,(H,14,15,16);/q;;+2/p-2 |
| InChIKey |
IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| SMILES |
[Ba+2].[S](=O)(=O)([O-])c3ccc(cc3)Nc4ccccc4.[S](=O)(=O)([O-])c1ccc(cc1)Nc2ccccc2 |
| CAS DataBase Reference |
6211-24-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 4-(phenylamino)-, barium salt (2:1) (6211-24-1) |