| Melting point |
258-263 °C (dec.) |
| alpha |
-64 º (c=1, pyridine, after) |
| Boiling point |
626.9±55.0 °C(Predicted) |
| Density |
1.522±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C |
| solubility |
Soluble in DMSO (40 mg/ml) |
| form |
Powder |
| pka |
12.73±0.70(Predicted) |
| color |
White to slightly off-white |
| Water Solubility |
soluble |
| Sensitive |
Moisture Sensitive & Hygroscopic |
| BRN |
94673 |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 1 month. |
| InChI |
InChI=1/C16H18O8/c1-7-4-12(18)23-10-5-8(2-3-9(7)10)22-16-15(21)14(20)13(19)11(6-17)24-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13+,14+,15-,16-/s3 |
| InChIKey |
YUDPTGPSBJVHCN-ZDHZLMEDNA-N |
| SMILES |
O(C1=CC2OC(C=C(C)C=2C=C1)=O)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |&1:13,15,18,20,22,r| |
| CAS DataBase Reference |
6160-78-7(CAS DataBase Reference) |