| Melting point |
274-275 °C(lit.) |
| Boiling point |
211.75°C (rough estimate) |
| Density |
1.5988 (rough estimate) |
| refractive index |
1.4264 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
1 M NH4OH: 50mg/mL, clear to slightly hazy, colorless to light yellow-green |
| form |
Fine Crystalline Powder |
| pka |
7.78±0.20(Predicted) |
| color |
White to light yellow |
| Water Solubility |
Partly soluble in water, ethanol, DMSO, and 1 M NH4OH (50 mg/ml). |
| BRN |
116472 |
| InChI |
InChI=1S/C3H3N3O2/c7-2-1-4-6-3(8)5-2/h1H,(H2,5,6,7,8) |
| InChIKey |
SSPYSWLZOPCOLO-UHFFFAOYSA-N |
| SMILES |
N1=CC(=O)NC(=O)N1 |
| CAS DataBase Reference |
461-89-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2,4-Triazine-3,5(2H,4H)-dione(461-89-2) |
| EPA Substance Registry System |
1,2,4-Triazine-3,5(2H,4H)-dione (461-89-2) |