| Melting point |
228-235°C |
| Flash point |
11 °C |
| storage temp. |
2-8°C |
| solubility |
Freely soluble to very soluble in water, very slightly soluble in alcohol, practically insoluble in methylene chloride. Solutions in water and in alcohol are unstable and are to be used immediately. |
| form |
Solid |
| color |
White to Pale Yellow |
| Major Application |
clinical testing |
| InChI |
1S/C16H12ClN2O4.2K/c17-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)18-14(15(20)21)16(22,23)19-12;;/h1-8,14,19,22H,(H,20,21);;/q-1;2*+1/p-1 |
| InChIKey |
UDKOZNXRMDPDLY-UHFFFAOYSA-M |
| SMILES |
O=C(O[K])C1N=C(C2=CC=CC=C2)C3=C(C=CC(Cl)=C3)NC1(O)O[K] |
| EPA Substance Registry System |
Clorazepate dipotassium (57109-90-7) |
