| Melting point |
212-215 °C (dec.) (lit.) |
| Boiling point |
537.5±60.0 °C(Predicted) |
| Density |
1.79 |
| refractive index |
15 ° (C=2, H2O) |
| storage temp. |
Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility |
DMSO (Slightly), Methanol (Slightly), Water (Sparingly) |
| pka |
pK1:4.21 (25°C) |
| form |
Solid |
| color |
Off-White to Pale Beige |
| PH |
4.3 |
| Water Solubility |
water: 25mg/mL, clear, colorless |
| λmax |
287 (pH 0);277 (pH 7) |
| Stability |
Hygroscopic |
| InChI |
InChI=1S/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7-,9-/m1/s1 |
| InChIKey |
ZAYHVCMSTBRABG-JXOAFFINSA-N |
| SMILES |
OC[C@H]1O[C@@H](N2C=C(C)C(N)=NC2=O)[C@H](O)[C@@H]1O |
| CAS DataBase Reference |
2140-61-6(CAS DataBase Reference) |