| Melting point |
131-134 °C (lit.) |
| Boiling point |
303°C (rough estimate) |
| Density |
1.44 g/cm3 (20℃) |
| vapor density |
7.31 |
| refractive index |
1.5388 (estimate) |
| Flash point |
350°F(COC) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
acetone: soluble25mg/mL, clear, colorless to light yellow |
| form |
Crystalline Powder |
| pka |
11.00±0.46(Predicted) |
| color |
Off-white to beige |
| InChI |
1S/C10H10ClNO2/c1-7(13)6-10(14)12-9-4-2-8(11)3-5-9/h2-5H,6H2,1H3,(H,12,14) |
| InChIKey |
JMRJWEJJUKUBEA-UHFFFAOYSA-N |
| SMILES |
CC(=O)CC(=O)Nc1ccc(Cl)cc1 |
| CAS DataBase Reference |
101-92-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Butanamide, N-(4-chlorophenyl)-3-oxo-(101-92-8) |
| EPA Substance Registry System |
Butanamide, N-(4-chlorophenyl)-3-oxo- (101-92-8) |
