| Melting point |
106-110℃ |
| Boiling point |
423.4±45.0 °C(Predicted) |
| Density |
1.032±0.06 g/cm3(Predicted) |
| storage temp. |
Store at -20°C |
| solubility |
DMSO:25.0(Max Conc. mg/mL);86.68(Max Conc. mM)
DMF:30.0(Max Conc. mg/mL);104.01(Max Conc. mM)
Ethanol:30.0(Max Conc. mg/mL);104.01(Max Conc. mM)
Ethanol:PBS (pH 7.2) (1:1):0.5(Max Conc. mg/mL);1.73(Max Conc. mM) |
| pka |
14.85±0.70(Predicted) |
| form |
Cyrstalline powder |
| color |
White to off-white |
| Water Solubility |
Soluble in water, ethanol, chloroform (slightly ), and acetone (slightly ). |
| Major Application |
pharmaceutical |
| InChI |
InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21) |
| InChIKey |
LEBVLXFERQHONN-UHFFFAOYSA-N |
| SMILES |
N1(CCCC)CCCCC1C(NC1=C(C)C=CC=C1C)=O |
| EPA Substance Registry System |
2-Piperidinecarboxamide, 1-butyl-N-(2,6-dimethylphenyl)- (38396-39-3) |
