38396-39-3
| Name | (±)-1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide |
| CAS | 38396-39-3 |
| EINECS(EC#) | 253-911-2 |
| Molecular Formula | C18H28N2O |
| MDL Number | MFCD00243007 |
| Molecular Weight | 288.43 |
| MOL File | 38396-39-3.mol |
Chemical Properties
| Melting point | 106-110℃ |
| Boiling point | 423.4±45.0 °C(Predicted) |
| density | 1.032±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO:25.0(Max Conc. mg/mL);86.68(Max Conc. mM) DMF:30.0(Max Conc. mg/mL);104.01(Max Conc. mM) Ethanol:30.0(Max Conc. mg/mL);104.01(Max Conc. mM) Ethanol:PBS (pH 7.2) (1:1):0.5(Max Conc. mg/mL);1.73(Max Conc. mM) |
| form | Cyrstalline powder |
| pka | 14.85±0.70(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water, ethanol, chloroform (slightly ), and acetone (slightly ). |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21) |
| InChIKey | LEBVLXFERQHONN-UHFFFAOYSA-N |
| SMILES | N1(CCCC)CCCCC1C(NC1=C(C)C=CC=C1C)=O |
| EPA Substance Registry System | 2-Piperidinecarboxamide, 1-butyl-N-(2,6-dimethylphenyl)- (38396-39-3) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H310-H330 |
| Precautionary statements | P301+P310a-P304+P340-P320-P330-P405-P501a |
| RIDADR | UN2811 |
| WGK Germany | WGK 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 38396-39-3(Hazardous Substances Data) |
