73360-54-0
| Name | Bupivacaine Hydrochloride |
| CAS | 73360-54-0 |
| EINECS(EC#) | 642-205-3 |
| Molecular Formula | C18H31ClN2O2 |
| MDL Number | MFCD00941462 |
| Molecular Weight | 342.91 |
| MOL File | 73360-54-0.mol |
Chemical Properties
| Melting point | 255-259℃ |
| RTECS | TK6125000 |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | neat |
| Water Solubility | Soluble in water to 50 mM, in DMSO to 100 mM and in ethanol to 100 mM. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C18H28N2O.ClH.H2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;;/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);1H;1H2 |
| InChIKey | HUCIWBPMHXGLFM-UHFFFAOYSA-N |
| SMILES | C(C1CCCCN1CCCC)(=O)NC1C(=CC=CC=1C)C.Cl.O |
Safety Data
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |