| Melting point |
245-248 °C (lit.) |
| Boiling point |
251.97°C (rough estimate) |
| Density |
1.2620 (rough estimate) |
| refractive index |
1.6910 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
insoluble in H2O; insoluble in EtOH; ≥13.7 mg/mL in DMSO |
| form |
powder to crystal |
| pka |
15.66±0.50(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
Soluble in Dimethyl sulfoxide (DMSO). Insoluble in water. |
| BRN |
116042 |
| InChI |
InChI=1S/C6H7N3O/c7-5-2-1-4(3-9-5)6(8)10/h1-3H,(H2,7,9)(H2,8,10) |
| InChIKey |
ZLWYEPMDOUQDBW-UHFFFAOYSA-N |
| SMILES |
C1=NC(N)=CC=C1C(N)=O |
| CAS DataBase Reference |
329-89-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Nicotinamide, 6-amino-(329-89-5) |
| EPA Substance Registry System |
6-Aminonicotinamide (329-89-5) |
