| Melting point |
70-72°C |
| Boiling point |
446.2±25.0 °C(Predicted) |
| Density |
0.927±0.06 g/cm3(Predicted) |
| storage temp. |
−20°C |
| solubility |
chloroform/methanol (9:1): 20 mg/mL, clear, colorless to faintly yellow |
| form |
Solid |
| pka |
12.57±0.45(Predicted) |
| color |
white |
| Water Solubility |
Soluble in water (partly miscible), chloroform, 100% warm ethanol (25 mg/ml), warm DMSO (25 mg/ml), and methanol. |
| InChI |
InChI=1/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3/t17-,18+/s3 |
| InChIKey |
OTKJDMGTUTTYMP-LHIQYTEENA-N |
| SMILES |
C(O)[C@@H](N)[C@@H](O)CCCCCCCCCCCCCCC |&1:2,4,r| |
| CAS DataBase Reference |
3102-56-5(CAS DataBase Reference) |
