| Boiling point |
222-232 °C(lit.) |
| Density |
0.913 g/mL at 25 °C(lit.) |
| vapor pressure |
4Pa at 20℃ |
| refractive index |
n20/D 1.426(lit.) |
| Flash point |
205 °F |
| storage temp. |
Store at room temperature, keep dry and cool |
| form |
liquid |
| pka |
14.41±0.20(Predicted) |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
40g/L at 25℃ |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C10H22O3/c1-4-5-6-12-8-10(3)13-7-9(2)11/h9-11H,4-8H2,1-3H3 |
| InChIKey |
CUVLMZNMSPJDON-UHFFFAOYSA-N |
| SMILES |
C(OC(C)COCCCC)C(O)C |
| LogP |
1.52 at 20℃ |
| CAS DataBase Reference |
29911-28-2 |
| EPA Substance Registry System |
1-(2-Butoxy-1-methylethoxy)-2-propanol (29911-28-2) |
