| Melting point |
110-112°C |
| Boiling point |
476.8±40.0 °C(Predicted) |
| Density |
1.241±0.06 g/cm3(Predicted) |
| vapor pressure |
0.001-0.05Pa at 20-109.84℃ |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
solid |
| pka |
13.96±0.46(Predicted) |
| color |
White to Light yellow to Light orange |
| InChI |
InChI=1S/C13H13N3O2/c1-15-13(17)12-8-11(6-7-16-12)18-10-4-2-9(14)3-5-10/h2-8H,14H2,1H3,(H,15,17) |
| InChIKey |
RXZZBPYPZLAEFC-UHFFFAOYSA-N |
| SMILES |
C1(C(NC)=O)=NC=CC(OC2=CC=C(N)C=C2)=C1 |
| LogP |
0.9 at 25℃ and pH7 |
| Surface tension |
71.71mN/m at 883.8mg/L and 20.1℃ |