| Melting point |
80-110 °C(lit.) |
| Boiling point |
388.6±42.0 °C(Predicted) |
| Density |
1.52 |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
Acetonitrile (Slightly), Chloroform (Slightly, Heated, Sonicated), Dichlorometha |
| form |
Crystalline Powder or Solid |
| color |
White to gray |
| optical activity |
[α]/D 188 to 198 °, c =1% (w/v) in ethyl acetate |
| BRN |
96281 |
| Stability |
Moisture and Temperature Sensitive |
| InChI |
InChI=1/C13H17BrO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8-,9-,10+,11-,12-/s3 |
| InChIKey |
BCDVKFMSIQGEHB-CIQUZCHMSA-N |
| SMILES |
O([C@@H]1[C@H]([C@@H](Br)O[C@H](C(=O)OC)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,6,11,r| |
| CAS DataBase Reference |
21085-72-3(CAS DataBase Reference) |