Acetobromo-alpha-D-glucuronic acid methyl ester
- Product NameAcetobromo-alpha-D-glucuronic acid methyl ester
- CAS21085-72-3
- CBNumberCB8396406
- MFC13H17BrO9
- MW397.17
- EINECS244-203-4
- MDL NumberMFCD00061613
- MOL File21085-72-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 80-110 °C(lit.) |
| Boiling point | 388.6±42.0 °C(Predicted) |
| Density | 1.52 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly, Heated, Sonicated), Dichlorometha |
| form | Crystalline Powder or Solid |
| color | White to gray |
| optical activity | [α]/D 188 to 198 °, c =1% (w/v) in ethyl acetate |
| BRN | 96281 |
| Stability | Moisture and Temperature Sensitive |
| InChI | InChI=1/C13H17BrO9/c1-5(15)20-8-9(21-6(2)16)11(13(18)19-4)23-12(14)10(8)22-7(3)17/h8-12H,1-4H3/t8-,9-,10+,11-,12-/s3 |
| InChIKey | BCDVKFMSIQGEHB-CIQUZCHMSA-N |
| SMILES | O([C@@H]1[C@H]([C@@H](Br)O[C@H](C(=O)OC)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,6,11,r| |
| CAS DataBase Reference | 21085-72-3(CAS DataBase Reference) |
| UNSPSC Code | 12352201 |
| NACRES | NA.25 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-8-10-21 |
| Hazard Note | Irritant/Store Cold under -20oC |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |

