| Melting point |
239-243 °C (lit.) |
| Boiling point |
348.4±42.0 °C(Predicted) |
| Density |
1.401±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
very slightly in Methanol |
| form |
powder to crystal |
| pka |
4+-.0.10(Predicted) |
| color |
White to Light yellow to Light red |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C8H8ClNO2/c1-4-2-5(9)3-6(7(4)10)8(11)12/h2-3H,10H2,1H3,(H,11,12) |
| InChIKey |
KOPXCQUAFDWYOE-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC(Cl)=CC(C)=C1N |
| CAS DataBase Reference |
20776-67-4(CAS DataBase Reference) |