| Boiling point |
264 °C |
| Density |
0.89 |
| vapor pressure |
2.4Pa at 24℃ |
| refractive index |
1.4526 (589.3 nm 20℃) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Practically insoluble in water, soluble in alcohol and oils. |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Odor |
at 100.00 %. fresh fruity peach isojasmone oily tropical |
| Odor Type |
fruity |
| Water Solubility |
31mg/L at 24℃ |
| InChI |
InChI=1S/C12H22O/c1-2-3-4-5-6-8-11-9-7-10-12(11)13/h11H,2-10H2,1H3 |
| InChIKey |
PJXHBTZLHITWFX-UHFFFAOYSA-N |
| SMILES |
C1(=O)CCCC1CCCCCCC |
| LogP |
3.8 at 25℃ |
| CAS DataBase Reference |
137-03-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Cyclopentanone, 2-heptyl- (137-03-1) |