| Melting point |
52-54 °C |
| Boiling point |
403.4±18.0 °C(Predicted) |
| Density |
1.1985 (rough estimate) |
| refractive index |
1.4650 (estimate) |
| Flash point |
113 °C |
| storage temp. |
RT |
| solubility |
methanol: soluble1g/10 mL, clear, colorless |
| form |
solid |
| pka |
2.97±0.21(Predicted) |
| color |
White |
| BRN |
1726517 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 2 months. |
| InChI |
InChI=1S/C16H31BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14H2,1H3,(H,18,19) |
| InChIKey |
DPRAYRYQQAXQPE-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C(Br)CCCCCCCCCCCCCC |
| CAS DataBase Reference |
18263-25-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Hexadecanoic acid, 2-bromo- (18263-25-7) |
