| Melting point |
106-110 °C (lit.) |
| Boiling point |
262 °C (lit.) |
| Density |
1.01 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.6088(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
almost transparency in Toluene |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
2mg/L(25 ºC) |
| BRN |
1903544 |
| Henry's Law Constant |
7.8×10-3 mol/(m3Pa) at 25℃, Mackay et al. (2006) |
| InChI |
InChI=1S/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 |
| InChIKey |
YGYNBBAUIYTWBF-UHFFFAOYSA-N |
| SMILES |
C1=C2C(C=C(C)C=C2)=CC=C1C |
| LogP |
4.310 |
| CAS DataBase Reference |
581-42-0(CAS DataBase Reference) |
| EPA Substance Registry System |
2,6-Dimethylnaphthalene (581-42-0) |