| Melting point |
156-157°C |
| Boiling point |
376.6±15.0 °C(Predicted) |
| Density |
1.367±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| pka |
14.89±0.40(Predicted) |
| form |
Liquid or Solid |
| color |
Clear, colorless or white to pale yellow |
| InChI |
InChI=1S/C7H7N3/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H3,8,9,10) |
| InChIKey |
YDTDKKULPWTHRV-UHFFFAOYSA-N |
| SMILES |
N1C2=C(C=CC=C2)C(N)=N1 |
| CAS DataBase Reference |
874-05-5(CAS DataBase Reference) |
| EPA Substance Registry System |
1H-Indazol-3-amine (874-05-5) |