| Boiling point |
180 °C |
| Density |
0.866 |
| vapor pressure |
64Pa at 25℃ |
| refractive index |
n20/D 1.399 |
| Flash point |
51°C |
| storage temp. |
2-8°C, stored under nitrogen |
| form |
clear liquid |
| Specific Gravity |
0.866 |
| color |
Colorless to Almost colorless |
| Water Solubility |
130mg/L at 20℃ |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| InChI |
InChI=1S/C11H24O3Si/c1-8-15(12-9(2)3,13-10(4)5)14-11(6)7/h8-11H,1H2,2-7H3 |
| InChIKey |
MABAWBWRUSBLKQ-UHFFFAOYSA-N |
| SMILES |
[Si](C=C)(OC(C)C)(OC(C)C)OC(C)C |
| LogP |
3.8 at 20℃ |
| NIST Chemistry Reference |
Silane, (triisopropyloxy)vinyl-(18023-33-1) |
| EPA Substance Registry System |
Silane, ethenyltris(1-methylethoxy)- (18023-33-1) |
