| Melting point |
182 °C (dec.) (lit.) |
| alpha |
13 º (c=1, H2O 24 ºC) |
| Boiling point |
287.44°C (rough estimate) |
| Density |
1.3482 (rough estimate) |
| refractive index |
29 ° (C=2, 6mol/L HCl) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility |
Soluble in water |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka |
2.18±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
[α]20/D +29°, c = 2 in 6 M HCl |
| BRN |
1725252 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C6H11NO4/c1-11-5(8)3-2-4(7)6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey |
ZGEYCCHDTIDZAE-BYPYZUCNSA-N |
| SMILES |
C(O)(=O)[C@H](CCC(OC)=O)N |
| CAS DataBase Reference |
1499-55-4(CAS DataBase Reference) |
