| Melting point |
-20 °C |
| Boiling point |
158 °C / 2mmHg |
| Density |
1,05 g/cm3 |
| vapor pressure |
0.002Pa at 25℃ |
| refractive index |
1.5420 (estimate) |
| Flash point |
177 °C |
| storage temp. |
0-6°C |
| solubility |
Chloroform: Slightly Soluble,DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| form |
Liquid |
| pka |
-7.53±0.20(Predicted) |
| color |
Light yellow to yellow |
| Water Solubility |
15mg/L at 25℃ |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
ANTIMICROBIAL |
| InChI |
1S/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3/t11?,12-,13+,14?,15? |
| InChIKey |
WLLGXSLBOPFWQV-OTHKPKEBSA-N |
| SMILES |
CCCCC(CC)CN1C(=O)C2[C@H]3C[C@H](C=C3)C2C1=O |
| LogP |
3.71 at 24℃ |
| CAS DataBase Reference |
113-48-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
N-(2-ethylhexyl)-5-norbornene-2,3-dicarboximide(113-48-4) |
| EPA Substance Registry System |
N-2-Ethylhexylbicycloheptenedicarboximide (113-48-4) |