N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide
- Product NameN-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide
- CAS113-48-4
- MFC17H25NO2
- MW275.39
- EINECS204-029-1
- MOL File113-48-4.mol
Chemical Properties
| Melting point | -20 °C |
| Boiling point | 158 °C / 2mmHg |
| Density | 1,05 g/cm3 |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.5420 (estimate) |
| Flash point | 177 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform: Slightly Soluble,DMSO: Slightly Soluble,Methanol: Slightly Soluble |
| form | Liquid |
| pka | -7.53±0.20(Predicted) |
| color | Light yellow to yellow |
| Water Solubility | 15mg/L at 25℃ |
| Henry's Law Constant | 3.5×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | 1S/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3/t11,12-,13+,14,15 |
| InChIKey | WLLGXSLBOPFWQV-OTHKPKEBSA-N |
| SMILES | CCCCC(CC)CN1C(=O)C2[C@H]3C[C@H](C=C3)C2C1=O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-21 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | RB8575000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 2 Skin Sens. 1B |
| Hazardous Substances Data | 113-48-4(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 2800mg/kg |
