| Melting point |
95.86°C (estimate) |
| Boiling point |
412.89°C (rough estimate) |
| Density |
1.5000 (estimate) |
| vapor pressure |
3.22 at 25 °C (estimated using GC retention data, Foreman and Bidleman, 1985) |
| refractive index |
1.6200 (estimate) |
| Flash point |
-12 °C |
| storage temp. |
room temp |
| solubility |
(wt %): Pyridine (114 at 31 °C), diglycol monoethyl ether (173 at 26 °C), methanol (15 at 26 °C), ethanol
(10 at 27 °C) (Monsanto, 1960) |
| Water Solubility |
43ug/L(20 ºC) |
| Henry's Law Constant |
83.7 at 25 °C (gas stripping-UV spectrophotometry, Warner et al., 1987) |
| Exposure limits |
Potential occupational carcinogen. NIOSH REL: TWA 1 μg/m3, IDLH 5
mg/m3; OSHA PEL: TWA 0.5 mg/m3; ACGIH TLV: TWA 1 mg/m3 (adopted). |
| Stability |
Stable. Highly flammable. Incompatible with strong oxidizing agents. Attacks some forms of plastics and rubber. |
| Major Application |
environmental |
| InChI |
1S/C12H5Cl5/c13-8-3-1-2-6(10(8)15)7-4-5-9(14)12(17)11(7)16/h1-5H |
| InChIKey |
AUGNBQPSMWGAJE-UHFFFAOYSA-N |
| SMILES |
Clc1c(c(ccc1Cl)c2c(c(ccc2)Cl)Cl)Cl |
| EPA Substance Registry System |
Aroclor 1254 (11097-69-1) |
