| Melting point |
−8.5 °C (16.7 °F; 264.6 K) |
| Boiling point |
210 °C (410 °F; 483 K) (some decomp.) |
| Density |
0.993 g/cm3 |
| refractive index |
1.58 |
| Flash point |
67 °C |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
liquid |
| color |
Colorless to pale yellow or yellow-green |
| Water Solubility |
Not miscible or difficult to mix with water. |
| BRN |
1851372 |
| InChI |
InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| InChIKey |
KEIFWROAQVVDBN-UHFFFAOYSA-N |
| SMILES |
C1C2=C(C=CC=C2)C=CC1 |
| CAS DataBase Reference |
447-53-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Naphthalene, 1,2-dihydro- (447-53-0) |
