| Melting point |
−8 °C(lit.) |
| Boiling point |
89 °C16 mm Hg(lit.) |
| Density |
0.997 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.582(lit.) |
| Flash point |
153 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
liquid |
| color |
Colorless to Light yellow |
| Water Solubility |
Not miscible or difficult to mix with water. |
| BRN |
1851372 |
| InChI |
InChI=1S/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| InChIKey |
KEIFWROAQVVDBN-UHFFFAOYSA-N |
| SMILES |
C1C2=C(C=CC=C2)C=CC1 |
| CAS DataBase Reference |
447-53-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Naphthalene, 1,2-dihydro- (447-53-0) |
