Testosterone phenylpropionate
한글명:Testosterone phenylpropionate
카스 번호1255-49-8
상품명:Testosterone phenylpropionate
CBNumberCB6137357
분자식C28H36O3
포뮬러 무게420.58
MOL 파일1255-49-8.mol
화학적 성질
| 녹는점 | 116.5 °C |
| 끓는 점 | 497.74°C (rough estimate) |
| 밀도 | 1.0043 (rough estimate) |
| 굴절률 | 1.5460 (estimate) |
| 용해도 | DMF: 25 mg/mL; DMSO: 5 mg/mL; Ethanol: 15 mg/mL; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/mL |
| 수용성 | 2.25mg/L(25℃) |
| InChIKey | HHSXYDOROIURIP-FEZCWRLCSA-N |
| SMILES | [C@@]12(CC[C@]3(C)[C@H](CC[C@@]3([H])[C@@]1(CCC1=CC(=O)CC[C@]21C)[H])OC(=O)CCC1C=CC=CC=1)[H] |&1:0,3,5,8,10,19,r| |
| CAS 데이터베이스 | 1255-49-8(CAS DataBase Reference) |
| 위험품 표기 | Xn | |||||||||
| 위험 카페고리 넘버 | 20/21/22-40 | |||||||||
| 안전지침서 | 22-36 | |||||||||
| WGK 독일 | 3 | |||||||||
| RTECS 번호 | XA3105000 | |||||||||
| NFPA 704: |
|
In a 100 ml reaction flask, 0.397 g (3 mmol) of cinnamaldehyde was added.0.411g (1.5mmol) Nandrolone, 0.06g (0.3mmol) [Bmim][OAc] catalyst, 10ml 1,4-dioxane, heated to 120 ?? C and then reacted for 2h, after the reaction was completed, cooled to room temperature, added 30 ml of water and 20 ml of ethyl acetate were extracted, and the phases were allowed to stand. The organic phase was concentrated and crystallized to obtain the target product. The yield was 64%.